C41H59N4O6P — CID 174267875
N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutan-2-yl]-6-(methylamino)hexanamide (PubChem CID 174267875) has the molecular formula C41H59N4O6P and a molecular weight of 734.92 g/mol. Its IUPAC name is N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutan-2-yl]-6-(methylamino)hexanamide.
| Compound Name | N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutan-2-yl]-6-(methylamino)hexanamide |
|---|---|
| PubChem CID | 174267875 |
| Molecular Formula | C41H59N4O6P |
| Molecular Weight | 734.92 g/mol |
| Exact Mass | 734.42 |
| IUPAC Name | N-[1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxybutan-2-yl]-6-(methylamino)hexanamide |
| SMILES | CNCCCCCC(=O)NC(COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)C(C)OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C41H59N4O6P/c1-31(2)45(32(3)4)52(50-29-15-27-42)51-33(5)39(44-40(46)18-13-10-14-28-43-6)30-49-41(34-16-11-9-12-17-34,35-19-23-37(47-7)24-20-35)36-21-25-38(48-8)26-22-36/h9,11-12,16-17,19-26,31-33,39,43H,10,13-15,18,28-30H2,1-8H3,(H,44,46) |
| InChIKey | PEPAFLZACRUNBS-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.92 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|