C46H61F3N3O7P — CID 10909082
N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]cyclohexyl]-8,8,8-trifluoro-7-oxooctanamide (PubChem CID 10909082) has the molecular formula C46H61F3N3O7P and a molecular weight of 855.98 g/mol. Its IUPAC name is N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]cyclohexyl]-8,8,8-trifluoro-7-oxooctanamide.
| Compound Name | N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]cyclohexyl]-8,8,8-trifluoro-7-oxooctanamide |
|---|---|
| PubChem CID | 10909082 |
| Molecular Formula | C46H61F3N3O7P |
| Molecular Weight | 855.98 g/mol |
| Exact Mass | 855.42 |
| IUPAC Name | N-[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]cyclohexyl]-8,8,8-trifluoro-7-oxooctanamide |
| SMILES | COc1ccc(C(OCC2(COP(OCCC#N)N(C(C)C)C(C)C)CCC(NC(=O)CCCCCC(=O)C(F)(F)F)CC2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C46H61F3N3O7P/c1-34(2)52(35(3)4)60(58-31-13-30-50)59-33-44(28-26-39(27-29-44)51-43(54)17-12-8-11-16-42(53)46(47,48)49)32-57-45(36-14-9-7-10-15-36,37-18-22-40(55-5)23-19-37)38-20-24-41(56-6)25-21-38/h7,9-10,14-15,18-25,34-35,39H,8,11-13,16-17,26-29,31-33H2,1-6H3,(H,51,54) |
| InChIKey | FQBGSKMBBXLXIC-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.98 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|