C34H45N2O5P — CID 58798161
3-[[(2R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 58798161) has the molecular formula C34H45N2O5P and a molecular weight of 592.72 g/mol. Its IUPAC name is 3-[[(2R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 58798161 |
| Molecular Formula | C34H45N2O5P |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | 3-[[(2R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]butan-2-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OCC[C@@H](C)OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H45N2O5P/c1-26(2)36(27(3)4)42(40-24-11-23-35)41-28(5)22-25-39-34(29-12-9-8-10-13-29,30-14-18-32(37-6)19-15-30)31-16-20-33(38-7)21-17-31/h8-10,12-21,26-28H,11,22,24-25H2,1-7H3/t28-,42?/m1/s1 |
| InChIKey | QTYXEIMXWNEEOP-QHBARCIZSA-N |
| XLogP | 8.08 |
| TPSA | 73.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|