C43H49N2O6P — CID 163861627
3-[[di(propan-2-yl)amino]-[3-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethoxy]-1-(7-methyl-2-oxochromen-4-yl)propoxy]phosphanyl]oxypropanenitrile (PubChem CID 163861627) has the molecular formula C43H49N2O6P and a molecular weight of 720.85 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[3-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethoxy]-1-(7-methyl-2-oxochromen-4-yl)propoxy]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[3-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethoxy]-1-(7-methyl-2-oxochromen-4-yl)propoxy]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 163861627 |
| Molecular Formula | C43H49N2O6P |
| Molecular Weight | 720.85 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[3-[(4-methoxyphenyl)-(4-methylphenyl)-phenylmethoxy]-1-(7-methyl-2-oxochromen-4-yl)propoxy]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OCCC(OP(OCCC#N)N(C(C)C)C(C)C)c2cc(=O)oc3cc(C)ccc23)(c2ccccc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C43H49N2O6P/c1-30(2)45(31(3)4)52(49-26-11-25-44)51-40(39-29-42(46)50-41-28-33(6)16-23-38(39)41)24-27-48-43(34-12-9-8-10-13-34,35-17-14-32(5)15-18-35)36-19-21-37(47-7)22-20-36/h8-10,12-23,28-31,40H,11,24,26-27H2,1-7H3 |
| InChIKey | DZACZVPAAZYCGT-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.85 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|