C47H53N2O6P — CID 11205017
3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(4-phenylphenyl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 11205017) has the molecular formula C47H53N2O6P and a molecular weight of 772.92 g/mol. Its IUPAC name is 3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(4-phenylphenyl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(4-phenylphenyl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 11205017 |
| Molecular Formula | C47H53N2O6P |
| Molecular Weight | 772.92 g/mol |
| Exact Mass | 772.36 |
| IUPAC Name | 3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(4-phenylphenyl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](c3ccc(-c4ccccc4)cc3)C[C@@H]2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C47H53N2O6P/c1-34(2)49(35(3)4)56(53-31-13-30-48)55-45-32-44(38-20-18-37(19-21-38)36-14-9-7-10-15-36)54-46(45)33-52-47(39-16-11-8-12-17-39,40-22-26-42(50-5)27-23-40)41-24-28-43(51-6)29-25-41/h7-12,14-29,34-35,44-46H,13,31-33H2,1-6H3/t44-,45+,46-,56?/m1/s1 |
| InChIKey | WJQRSJBTWPTPGI-WDOKDSJLSA-N |
| XLogP | 10.87 |
| TPSA | 82.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.92 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|