C41H47N2O6PS — CID 102342216
3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-ethynylthiophen-2-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 102342216) has the molecular formula C41H47N2O6PS and a molecular weight of 726.88 g/mol. Its IUPAC name is 3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-ethynylthiophen-2-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-ethynylthiophen-2-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 102342216 |
| Molecular Formula | C41H47N2O6PS |
| Molecular Weight | 726.88 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | 3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-ethynylthiophen-2-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | C#Cc1ccc([C@H]2C[C@H](OP(OCCC#N)N(C(C)C)C(C)C)[C@@H](COC(c3ccccc3)(c3ccc(OC)cc3)c3ccc(OC)cc3)O2)s1 |
| InChI | InChI=1S/C41H47N2O6PS/c1-8-36-23-24-40(51-36)38-27-37(49-50(47-26-12-25-42)43(29(2)3)30(4)5)39(48-38)28-46-41(31-13-10-9-11-14-31,32-15-19-34(44-6)20-16-32)33-17-21-35(45-7)22-18-33/h1,9-11,13-24,29-30,37-39H,12,26-28H2,2-7H3/t37-,38+,39+,50?/m0/s1 |
| InChIKey | MRGIRWZSRCXRDD-PSMAWVAASA-N |
| XLogP | 9.25 |
| TPSA | 82.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.88 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|