C39H50N3O6P — CID 118491518
3-[[(2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,3-dihydropyrrol-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 118491518) has the molecular formula C39H50N3O6P and a molecular weight of 687.82 g/mol. Its IUPAC name is 3-[[(2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,3-dihydropyrrol-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[(2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,3-dihydropyrrol-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 118491518 |
| Molecular Formula | C39H50N3O6P |
| Molecular Weight | 687.82 g/mol |
| Exact Mass | 687.34 |
| IUPAC Name | 3-[[(2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,3-dihydropyrrol-1-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](N3C=CCC3)C[C@H]2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H50N3O6P/c1-29(2)42(30(3)4)49(46-26-12-23-40)48-36-27-38(41-24-10-11-25-41)47-37(36)28-45-39(31-13-8-7-9-14-31,32-15-19-34(43-5)20-16-32)33-17-21-35(44-6)22-18-33/h7-10,13-22,24,29-30,36-38H,11-12,25-28H2,1-6H3/t36-,37-,38-,49?/m1/s1 |
| InChIKey | LNTJPZCDTNHITL-FLKBWMFZSA-N |
| XLogP | 8.01 |
| TPSA | 85.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.82 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|