C47H53N4O7P — CID 10974853
N-[5-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-2-pyridinyl]benzamide (PubChem CID 10974853) has the molecular formula C47H53N4O7P and a molecular weight of 816.94 g/mol. Its IUPAC name is N-[5-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-2-pyridinyl]benzamide.
| Compound Name | N-[5-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 10974853 |
| Molecular Formula | C47H53N4O7P |
| Molecular Weight | 816.94 g/mol |
| Exact Mass | 816.37 |
| IUPAC Name | N-[5-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-2-pyridinyl]benzamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](c3ccc(NC(=O)c4ccccc4)nc3)C[C@@H]2OP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C47H53N4O7P/c1-33(2)51(34(3)4)59(56-29-13-28-48)58-43-30-42(36-18-27-45(49-31-36)50-46(52)35-14-9-7-10-15-35)57-44(43)32-55-47(37-16-11-8-12-17-37,38-19-23-40(53-5)24-20-38)39-21-25-41(54-6)26-22-39/h7-12,14-27,31,33-34,42-44H,13,29-30,32H2,1-6H3,(H,49,50,52)/t42-,43+,44-,59?/m1/s1 |
| InChIKey | YVMMIZLCGVNRHE-FRNDIXAASA-N |
| XLogP | 9.85 |
| TPSA | 124.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.94 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|