C38H44N3O7P — CID 67087915
3-[[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-nitrophenyl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 67087915) has the molecular formula C38H44N3O7P and a molecular weight of 685.76 g/mol. Its IUPAC name is 3-[[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-nitrophenyl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-nitrophenyl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 67087915 |
| Molecular Formula | C38H44N3O7P |
| Molecular Weight | 685.76 g/mol |
| Exact Mass | 685.29 |
| IUPAC Name | 3-[[4-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-nitrophenyl]methoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OCc2ccc(COP(OCCC#N)N(C(C)C)C(C)C)cc2[N+](=O)[O-])(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H44N3O7P/c1-28(2)40(29(3)4)49(47-24-10-23-39)48-26-30-13-14-31(37(25-30)41(42)43)27-46-38(32-11-8-7-9-12-32,33-15-19-35(44-5)20-16-33)34-17-21-36(45-6)22-18-34/h7-9,11-22,25,28-29H,10,24,26-27H2,1-6H3 |
| InChIKey | XDAOYORKJLRUMU-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 116.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.76 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|