C52H85N2O7PSi2 — CID 170904788
3-[[10-[bis(4-methoxyphenyl)-phenylmethoxy]-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]decoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 170904788) has the molecular formula C52H85N2O7PSi2 and a molecular weight of 937.40 g/mol. Its IUPAC name is 3-[[10-[bis(4-methoxyphenyl)-phenylmethoxy]-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]decoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[10-[bis(4-methoxyphenyl)-phenylmethoxy]-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]decoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 170904788 |
| Molecular Formula | C52H85N2O7PSi2 |
| Molecular Weight | 937.40 g/mol |
| Exact Mass | 936.56 |
| IUPAC Name | 3-[[10-[bis(4-methoxyphenyl)-phenylmethoxy]-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]decoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OCCCCCC(O[Si](C)(C)C(C)(C)C)C(CCCOP(OCCC#N)N(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C52H85N2O7PSi2/c1-41(2)54(42(3)4)62(59-40-24-37-53)58-39-23-28-49(61-64(15,16)51(8,9)10)48(60-63(13,14)50(5,6)7)27-21-18-22-38-57-52(43-25-19-17-20-26-43,44-29-33-46(55-11)34-30-44)45-31-35-47(56-12)36-32-45/h17,19-20,25-26,29-36,41-42,48-49H,18,21-24,27-28,38-40H2,1-16H3 |
| InChIKey | KLPRFLFQZLZHAH-UHFFFAOYSA-N |
| XLogP | 14.43 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.40 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|