C53H64Cl2N3O7P — CID 59510431
[4-[bis(4-methoxyphenyl)-phenylmethoxy]-1,1-bis(4-chlorophenyl)butyl] N-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexyl]carbamate (PubChem CID 59510431) has the molecular formula C53H64Cl2N3O7P and a molecular weight of 956.99 g/mol. Its IUPAC name is [4-[bis(4-methoxyphenyl)-phenylmethoxy]-1,1-bis(4-chlorophenyl)butyl] N-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexyl]carbamate.
| Compound Name | [4-[bis(4-methoxyphenyl)-phenylmethoxy]-1,1-bis(4-chlorophenyl)butyl] N-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexyl]carbamate |
|---|---|
| PubChem CID | 59510431 |
| Molecular Formula | C53H64Cl2N3O7P |
| Molecular Weight | 956.99 g/mol |
| Exact Mass | 955.39 |
| IUPAC Name | [4-[bis(4-methoxyphenyl)-phenylmethoxy]-1,1-bis(4-chlorophenyl)butyl] N-[6-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyhexyl]carbamate |
| SMILES | COc1ccc(C(OCCCC(OC(=O)NCCCCCCOP(OCCC#N)N(C(C)C)C(C)C)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C53H64Cl2N3O7P/c1-40(2)58(41(3)4)66(64-39-15-35-56)63-38-13-8-7-12-36-57-51(59)65-52(42-18-26-47(54)27-19-42,43-20-28-48(55)29-21-43)34-14-37-62-53(44-16-10-9-11-17-44,45-22-30-49(60-5)31-23-45)46-24-32-50(61-6)33-25-46/h9-11,16-33,40-41H,7-8,12-15,34,36-39H2,1-6H3,(H,57,59) |
| InChIKey | HAKMWXOGWOGZEW-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.99 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|