C42H56N3O7P — CID 11115322
[(3E)-hexa-3,5-dienyl] N-[(3R)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypentyl]carbamate (PubChem CID 11115322) has the molecular formula C42H56N3O7P and a molecular weight of 745.90 g/mol. Its IUPAC name is [(3E)-hexa-3,5-dienyl] N-[(3R)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypentyl]carbamate.
| Compound Name | [(3E)-hexa-3,5-dienyl] N-[(3R)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypentyl]carbamate |
|---|---|
| PubChem CID | 11115322 |
| Molecular Formula | C42H56N3O7P |
| Molecular Weight | 745.90 g/mol |
| Exact Mass | 745.39 |
| IUPAC Name | [(3E)-hexa-3,5-dienyl] N-[(3R)-5-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypentyl]carbamate |
| SMILES | C=C/C=C/CCOC(=O)NCC[C@H](CCOC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C42H56N3O7P/c1-8-9-10-14-30-49-41(46)44-29-26-40(52-53(51-31-15-28-43)45(33(2)3)34(4)5)27-32-50-42(35-16-12-11-13-17-35,36-18-22-38(47-6)23-19-36)37-20-24-39(48-7)25-21-37/h8-13,16-25,33-34,40H,1,14-15,26-27,29-32H2,2-7H3,(H,44,46)/b10-9+/t40-,53?/m1/s1 |
| InChIKey | KAMUVTTXMGZQLS-OGRXWLEWSA-N |
| XLogP | 9.31 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.90 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|