C33H43N2O4PS2 — CID 166138054
3-[[di(propan-2-yl)amino]-[2-[2-[(4-methoxyphenyl)-diphenylmethoxy]ethyldisulfanyl]ethoxy]phosphanyl]oxypropanenitrile (PubChem CID 166138054) has the molecular formula C33H43N2O4PS2 and a molecular weight of 626.82 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[2-[2-[(4-methoxyphenyl)-diphenylmethoxy]ethyldisulfanyl]ethoxy]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[2-[2-[(4-methoxyphenyl)-diphenylmethoxy]ethyldisulfanyl]ethoxy]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 166138054 |
| Molecular Formula | C33H43N2O4PS2 |
| Molecular Weight | 626.82 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[2-[2-[(4-methoxyphenyl)-diphenylmethoxy]ethyldisulfanyl]ethoxy]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(OCCSSCCOP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H43N2O4PS2/c1-27(2)35(28(3)4)40(38-22-12-21-34)39-24-26-42-41-25-23-37-33(29-13-8-6-9-14-29,30-15-10-7-11-16-30)31-17-19-32(36-5)20-18-31/h6-11,13-20,27-28H,12,22-26H2,1-5H3 |
| InChIKey | FRZKACSAVXPRSA-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.82 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|