C34H45N2O4PS3 — CID 166138055
3-[2-[2-[bis(4-methoxyphenyl)-phenylmethyl]sulfanylethyldisulfanyl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 166138055) has the molecular formula C34H45N2O4PS3 and a molecular weight of 672.92 g/mol. Its IUPAC name is 3-[2-[2-[bis(4-methoxyphenyl)-phenylmethyl]sulfanylethyldisulfanyl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[2-[2-[bis(4-methoxyphenyl)-phenylmethyl]sulfanylethyldisulfanyl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 166138055 |
| Molecular Formula | C34H45N2O4PS3 |
| Molecular Weight | 672.92 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | 3-[2-[2-[bis(4-methoxyphenyl)-phenylmethyl]sulfanylethyldisulfanyl]ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(SCCSSCCOP(OCCC#N)N(C(C)C)C(C)C)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H45N2O4PS3/c1-27(2)36(28(3)4)41(39-22-10-21-35)40-23-24-43-44-26-25-42-34(29-11-8-7-9-12-29,30-13-17-32(37-5)18-14-30)31-15-19-33(38-6)20-16-31/h7-9,11-20,27-28H,10,22-26H2,1-6H3 |
| InChIKey | BKETVLRYLSPZLE-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.92 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|