C31H38IN2O4P — CID 177062786
3-[[di(propan-2-yl)amino]-[2-(4-iodophenyl)-2,2-bis(4-methoxyphenyl)ethoxy]phosphanyl]oxypropanenitrile (PubChem CID 177062786) has the molecular formula C31H38IN2O4P and a molecular weight of 660.53 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[2-(4-iodophenyl)-2,2-bis(4-methoxyphenyl)ethoxy]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[2-(4-iodophenyl)-2,2-bis(4-methoxyphenyl)ethoxy]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 177062786 |
| Molecular Formula | C31H38IN2O4P |
| Molecular Weight | 660.53 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[2-(4-iodophenyl)-2,2-bis(4-methoxyphenyl)ethoxy]phosphanyl]oxypropanenitrile |
| SMILES | COc1ccc(C(COP(OCCC#N)N(C(C)C)C(C)C)(c2ccc(I)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H38IN2O4P/c1-23(2)34(24(3)4)39(37-21-7-20-33)38-22-31(25-8-14-28(32)15-9-25,26-10-16-29(35-5)17-11-26)27-12-18-30(36-6)19-13-27/h8-19,23-24H,7,21-22H2,1-6H3 |
| InChIKey | YIMZVGNLLWDZOB-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.53 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|