C13H27N2O2P — CID 46852394
3-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 46852394) has the molecular formula C13H27N2O2P and a molecular weight of 274.34 g/mol. Its IUPAC name is 3-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 46852394 |
| Molecular Formula | C13H27N2O2P |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 3-[butoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CCCCOP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C13H27N2O2P/c1-6-7-10-16-18(17-11-8-9-14)15(12(2)3)13(4)5/h12-13H,6-8,10-11H2,1-5H3 |
| InChIKey | IICOXFTVYLVMBH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|