C21H45N2O3P — CID 170645688
3-[[di(propan-2-yl)amino]-[3-methyl-3-(3-methylbutoxy)butoxy]phosphanyl]oxypropanenitrile;ethane (PubChem CID 170645688) has the molecular formula C21H45N2O3P and a molecular weight of 404.58 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[3-methyl-3-(3-methylbutoxy)butoxy]phosphanyl]oxypropanenitrile;ethane.
| Compound Name | 3-[[di(propan-2-yl)amino]-[3-methyl-3-(3-methylbutoxy)butoxy]phosphanyl]oxypropanenitrile;ethane |
|---|---|
| PubChem CID | 170645688 |
| Molecular Formula | C21H45N2O3P |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[3-methyl-3-(3-methylbutoxy)butoxy]phosphanyl]oxypropanenitrile;ethane |
| SMILES | CC.CC(C)CCOC(C)(C)CCOP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C19H39N2O3P.C2H6/c1-16(2)10-14-22-19(7,8)11-15-24-25(23-13-9-12-20)21(17(3)4)18(5)6;1-2/h16-18H,9-11,13-15H2,1-8H3;1-2H3 |
| InChIKey | LEYYTMHNCVVVQJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 54.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|