C25H35N2O2P — CID 166498758
3-[[4-(4-tert-butylphenyl)phenoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 166498758) has the molecular formula C25H35N2O2P and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-[[4-(4-tert-butylphenyl)phenoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[4-(4-tert-butylphenyl)phenoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 166498758 |
| Molecular Formula | C25H35N2O2P |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 3-[[4-(4-tert-butylphenyl)phenoxy]-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)Oc1ccc(-c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H35N2O2P/c1-19(2)27(20(3)4)30(28-18-8-17-26)29-24-15-11-22(12-16-24)21-9-13-23(14-10-21)25(5,6)7/h9-16,19-20H,8,18H2,1-7H3 |
| InChIKey | LDGHPZRNIHPOSN-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|