C12H21N2O2P — CID 166792181
3-[[di(propan-2-yl)amino]-prop-2-ynoxyphosphanyl]oxypropanenitrile (PubChem CID 166792181) has the molecular formula C12H21N2O2P and a molecular weight of 256.29 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-prop-2-ynoxyphosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-prop-2-ynoxyphosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 166792181 |
| Molecular Formula | C12H21N2O2P |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-prop-2-ynoxyphosphanyl]oxypropanenitrile |
| SMILES | C#CCOP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C12H21N2O2P/c1-6-9-15-17(16-10-7-8-13)14(11(2)3)12(4)5/h1,11-12H,7,9-10H2,2-5H3 |
| InChIKey | QSDBSAKHULFXHA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|