C29H37N2O2PSi — CID 10006330
3-[[di(propan-2-yl)amino]-(2-triphenylsilylethoxy)phosphanyl]oxypropanenitrile (PubChem CID 10006330) has the molecular formula C29H37N2O2PSi and a molecular weight of 504.69 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-(2-triphenylsilylethoxy)phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-(2-triphenylsilylethoxy)phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 10006330 |
| Molecular Formula | C29H37N2O2PSi |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-(2-triphenylsilylethoxy)phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H37N2O2PSi/c1-25(2)31(26(3)4)34(32-22-14-21-30)33-23-24-35(27-15-8-5-9-16-27,28-17-10-6-11-18-28)29-19-12-7-13-20-29/h5-13,15-20,25-26H,14,22-24H2,1-4H3 |
| InChIKey | LHMREYMTDIUGIV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|