C37H60N5O5P — CID 101245096
3-[2-(10,16-dibenzyl-1,7,13-trioxa-4,10,16-triazacyclooctadec-4-yl)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 101245096) has the molecular formula C37H60N5O5P and a molecular weight of 685.89 g/mol. Its IUPAC name is 3-[2-(10,16-dibenzyl-1,7,13-trioxa-4,10,16-triazacyclooctadec-4-yl)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[2-(10,16-dibenzyl-1,7,13-trioxa-4,10,16-triazacyclooctadec-4-yl)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 101245096 |
| Molecular Formula | C37H60N5O5P |
| Molecular Weight | 685.89 g/mol |
| Exact Mass | 685.43 |
| IUPAC Name | 3-[2-(10,16-dibenzyl-1,7,13-trioxa-4,10,16-triazacyclooctadec-4-yl)ethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCCN1CCOCCN(Cc2ccccc2)CCOCCN(Cc2ccccc2)CCOCC1 |
| InChI | InChI=1S/C37H60N5O5P/c1-34(2)42(35(3)4)48(46-24-11-16-38)47-31-23-39-17-25-43-27-19-40(32-36-12-7-5-8-13-36)21-29-45-30-22-41(20-28-44-26-18-39)33-37-14-9-6-10-15-37/h5-10,12-15,34-35H,11,17-33H2,1-4H3 |
| InChIKey | IIBPMXGGAJFROD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.89 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|