About dilithium;4-benzylmorpholine;sulfite
dilithium;4-benzylmorpholine;sulfite (PubChem CID 160525639) has the molecular formula C11H15Li2NO4S
and a molecular weight of 271.19 g/mol. Its IUPAC name is dilithium;4-benzylmorpholine;sulfite.
Molecular Properties
| Compound Name | dilithium;4-benzylmorpholine;sulfite |
| PubChem CID | 160525639 |
| Molecular Formula | C11H15Li2NO4S |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | dilithium;4-benzylmorpholine;sulfite |
| SMILES | O=S([O-])[O-].[Li+].[Li+].c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C11H15NO.2Li.H2O3S/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12;;;1-4(2)3/h1-5H,6-10H2;;;(H2,1,2,3)/q;2*+1;/p-2 |
| InChIKey | CQNWWAAGKDYDJL-UHFFFAOYSA-L |
| XLogP | -5.48 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | -5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze dilithium;4-benzylmorpholine;sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;4-benzylmorpholine;sulfite?
The IUPAC name of dilithium;4-benzylmorpholine;sulfite (CID 160525639) is dilithium;4-benzylmorpholine;sulfite.
What is the SMILES notation for dilithium;4-benzylmorpholine;sulfite?
The canonical SMILES for dilithium;4-benzylmorpholine;sulfite is O=S([O-])[O-].[Li+].[Li+].c1ccc(CN2CCOCC2)cc1.
What is the InChIKey of dilithium;4-benzylmorpholine;sulfite?
The InChIKey is CQNWWAAGKDYDJL-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H15NO.2Li.H2O3S/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12;;;1-4(2)3/h1-5H,6-10H2;;;(H2,1,2,3)/q;2*+1;/p-2.
What are the key properties of dilithium;4-benzylmorpholine;sulfite?
dilithium;4-benzylmorpholine;sulfite has a molecular weight of 271.19 g/mol, XLogP of -5.48, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;4-benzylmorpholine;sulfite is sourced from PubChem (CID 160525639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).