C19H22N2O3S — CID 71063992
4-[[4-(1,3-dihydroisoindol-2-ylsulfonyl)phenyl]methyl]morpholine (PubChem CID 71063992) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is 4-[[4-(1,3-dihydroisoindol-2-ylsulfonyl)phenyl]methyl]morpholine.
| Compound Name | 4-[[4-(1,3-dihydroisoindol-2-ylsulfonyl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 71063992 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-[[4-(1,3-dihydroisoindol-2-ylsulfonyl)phenyl]methyl]morpholine |
| SMILES | O=S(=O)(c1ccc(CN2CCOCC2)cc1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C19H22N2O3S/c22-25(23,21-14-17-3-1-2-4-18(17)15-21)19-7-5-16(6-8-19)13-20-9-11-24-12-10-20/h1-8H,9-15H2 |
| InChIKey | ONZYKHVIKGSSLR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |