C22H30N4O2S2 — CID 145471447
N-[4-[[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]methyl]piperazin-1-yl]sulfanyl-N-methylmethanamine (PubChem CID 145471447) has the molecular formula C22H30N4O2S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is N-[4-[[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]methyl]piperazin-1-yl]sulfanyl-N-methylmethanamine.
| Compound Name | N-[4-[[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]methyl]piperazin-1-yl]sulfanyl-N-methylmethanamine |
|---|---|
| PubChem CID | 145471447 |
| Molecular Formula | C22H30N4O2S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[4-[[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]methyl]piperazin-1-yl]sulfanyl-N-methylmethanamine |
| SMILES | CN(C)SN1CCN(Cc2ccc(S(=O)(=O)N3CCc4ccccc4C3)cc2)CC1 |
| InChI | InChI=1S/C22H30N4O2S2/c1-23(2)29-25-15-13-24(14-16-25)17-19-7-9-22(10-8-19)30(27,28)26-12-11-20-5-3-4-6-21(20)18-26/h3-10H,11-18H2,1-2H3 |
| InChIKey | DQWBRTGEHLYJPW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|