C23H21NO4S — CID 162140089
phenyl 2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]acetate (PubChem CID 162140089) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is phenyl 2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]acetate.
| Compound Name | phenyl 2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]acetate |
|---|---|
| PubChem CID | 162140089 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | phenyl 2-[4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)phenyl]acetate |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCc3ccccc3C2)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C23H21NO4S/c25-23(28-21-8-2-1-3-9-21)16-18-10-12-22(13-11-18)29(26,27)24-15-14-19-6-4-5-7-20(19)17-24/h1-13H,14-17H2 |
| InChIKey | VJADLMYEQHJHQN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|