C22H27NO5S — CID 55569298
3-phenoxypropyl 2-(4-piperidin-1-ylsulfonylphenyl)acetate (PubChem CID 55569298) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is 3-phenoxypropyl 2-(4-piperidin-1-ylsulfonylphenyl)acetate.
| Compound Name | 3-phenoxypropyl 2-(4-piperidin-1-ylsulfonylphenyl)acetate |
|---|---|
| PubChem CID | 55569298 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-phenoxypropyl 2-(4-piperidin-1-ylsulfonylphenyl)acetate |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)cc1)OCCCOc1ccccc1 |
| InChI | InChI=1S/C22H27NO5S/c24-22(28-17-7-16-27-20-8-3-1-4-9-20)18-19-10-12-21(13-11-19)29(25,26)23-14-5-2-6-15-23/h1,3-4,8-13H,2,5-7,14-18H2 |
| InChIKey | YJYPSFJSQBEEHF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|