C21H24ClNO5S — CID 38130843
2-(4-chlorophenoxy)ethyl 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate (PubChem CID 38130843) has the molecular formula C21H24ClNO5S and a molecular weight of 437.95 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 38130843 |
| Molecular Formula | C21H24ClNO5S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCC2)cc1)OCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24ClNO5S/c22-18-6-8-19(9-7-18)27-15-16-28-21(24)12-5-17-3-10-20(11-4-17)29(25,26)23-13-1-2-14-23/h3-4,6-11H,1-2,5,12-16H2 |
| InChIKey | QOTGANNLNVLNCB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|