C19H27NO4S — CID 55475357
[(E)-but-2-enyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]propanoate (PubChem CID 55475357) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is [(E)-but-2-enyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]propanoate.
| Compound Name | [(E)-but-2-enyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]propanoate |
|---|---|
| PubChem CID | 55475357 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | [(E)-but-2-enyl] 3-[4-(azepan-1-ylsulfonyl)phenyl]propanoate |
| SMILES | C/C=C/COC(=O)CCc1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H27NO4S/c1-2-3-16-24-19(21)13-10-17-8-11-18(12-9-17)25(22,23)20-14-6-4-5-7-15-20/h2-3,8-9,11-12H,4-7,10,13-16H2,1H3/b3-2+ |
| InChIKey | HLLCVWQGNXDPDQ-NSCUHMNNSA-N |
| XLogP | 3.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|