C21H25NO4S — CID 24505765
(2,6-dimethylphenyl) 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate (PubChem CID 24505765) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate.
| Compound Name | (2,6-dimethylphenyl) 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 24505765 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (2,6-dimethylphenyl) 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate |
| SMILES | Cc1cccc(C)c1OC(=O)CCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-16-6-5-7-17(2)21(16)26-20(23)13-10-18-8-11-19(12-9-18)27(24,25)22-14-3-4-15-22/h5-9,11-12H,3-4,10,13-15H2,1-2H3 |
| InChIKey | JQKFHWAMNPTIIZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|