C15H19NO5S — CID 24827910
methyl 3-[4-(4-oxopiperidin-1-yl)sulfonylphenyl]propanoate (PubChem CID 24827910) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is methyl 3-[4-(4-oxopiperidin-1-yl)sulfonylphenyl]propanoate.
| Compound Name | methyl 3-[4-(4-oxopiperidin-1-yl)sulfonylphenyl]propanoate |
|---|---|
| PubChem CID | 24827910 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | methyl 3-[4-(4-oxopiperidin-1-yl)sulfonylphenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(S(=O)(=O)N2CCC(=O)CC2)cc1 |
| InChI | InChI=1S/C15H19NO5S/c1-21-15(18)7-4-12-2-5-14(6-3-12)22(19,20)16-10-8-13(17)9-11-16/h2-3,5-6H,4,7-11H2,1H3 |
| InChIKey | YNMYIJFHOSZEPZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |