C24H30N2O6S — CID 55513242
methyl 3-[benzyl-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]amino]propanoate (PubChem CID 55513242) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is methyl 3-[benzyl-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]amino]propanoate.
| Compound Name | methyl 3-[benzyl-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 55513242 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | methyl 3-[benzyl-[3-(4-morpholin-4-ylsulfonylphenyl)propanoyl]amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)C(=O)CCc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H30N2O6S/c1-31-24(28)13-14-25(19-21-5-3-2-4-6-21)23(27)12-9-20-7-10-22(11-8-20)33(29,30)26-15-17-32-18-16-26/h2-8,10-11H,9,12-19H2,1H3 |
| InChIKey | QOXFIOYZHVVLBK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |