C26H34N2O5S — CID 55512905
methyl 3-[benzyl-[1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carbonyl]amino]propanoate (PubChem CID 55512905) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is methyl 3-[benzyl-[1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[benzyl-[1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 55512905 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | methyl 3-[benzyl-[1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)C(=O)C1CCN(S(=O)(=O)c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C26H34N2O5S/c1-20(2)22-9-11-24(12-10-22)34(31,32)28-17-13-23(14-18-28)26(30)27(16-15-25(29)33-3)19-21-7-5-4-6-8-21/h4-12,20,23H,13-19H2,1-3H3 |
| InChIKey | PJPYPWHAKNWKLC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |