C22H27FN2O3S — CID 26292191
N-benzyl-1-(2-fluorophenyl)sulfonyl-N-propylpiperidine-4-carboxamide (PubChem CID 26292191) has the molecular formula C22H27FN2O3S and a molecular weight of 418.53 g/mol. Its IUPAC name is N-benzyl-1-(2-fluorophenyl)sulfonyl-N-propylpiperidine-4-carboxamide.
| Compound Name | N-benzyl-1-(2-fluorophenyl)sulfonyl-N-propylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 26292191 |
| Molecular Formula | C22H27FN2O3S |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-benzyl-1-(2-fluorophenyl)sulfonyl-N-propylpiperidine-4-carboxamide |
| SMILES | CCCN(Cc1ccccc1)C(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H27FN2O3S/c1-2-14-24(17-18-8-4-3-5-9-18)22(26)19-12-15-25(16-13-19)29(27,28)21-11-7-6-10-20(21)23/h3-11,19H,2,12-17H2,1H3 |
| InChIKey | NPQXELAGNMRSFK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |