C19H27FN2O6S — CID 55726709
ethyl 2-[[1-(2-fluorophenyl)sulfonylpiperidine-4-carbonyl]-(2-methoxyethyl)amino]acetate (PubChem CID 55726709) has the molecular formula C19H27FN2O6S and a molecular weight of 430.50 g/mol. Its IUPAC name is ethyl 2-[[1-(2-fluorophenyl)sulfonylpiperidine-4-carbonyl]-(2-methoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[[1-(2-fluorophenyl)sulfonylpiperidine-4-carbonyl]-(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 55726709 |
| Molecular Formula | C19H27FN2O6S |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | ethyl 2-[[1-(2-fluorophenyl)sulfonylpiperidine-4-carbonyl]-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H27FN2O6S/c1-3-28-18(23)14-21(12-13-27-2)19(24)15-8-10-22(11-9-15)29(25,26)17-7-5-4-6-16(17)20/h4-7,15H,3,8-14H2,1-2H3 |
| InChIKey | ZMILVCQZDAUIQU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |