C14H17F2NO4 — CID 60620709
ethyl 2-[(2,3-difluorobenzoyl)-(2-methoxyethyl)amino]acetate (PubChem CID 60620709) has the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. Its IUPAC name is ethyl 2-[(2,3-difluorobenzoyl)-(2-methoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[(2,3-difluorobenzoyl)-(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 60620709 |
| Molecular Formula | C14H17F2NO4 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | ethyl 2-[(2,3-difluorobenzoyl)-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)c1cccc(F)c1F |
| InChI | InChI=1S/C14H17F2NO4/c1-3-21-12(18)9-17(7-8-20-2)14(19)10-5-4-6-11(15)13(10)16/h4-6H,3,7-9H2,1-2H3 |
| InChIKey | TYRRTTLTIABDQK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |