C14H19NO6 — CID 103892104
ethyl 2-[(3,5-dihydroxybenzoyl)-(2-methoxyethyl)amino]acetate (PubChem CID 103892104) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl 2-[(3,5-dihydroxybenzoyl)-(2-methoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[(3,5-dihydroxybenzoyl)-(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 103892104 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | ethyl 2-[(3,5-dihydroxybenzoyl)-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H19NO6/c1-3-21-13(18)9-15(4-5-20-2)14(19)10-6-11(16)8-12(17)7-10/h6-8,16-17H,3-5,9H2,1-2H3 |
| InChIKey | OILWRIVVEBYRJL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |