C17H20FNO4S — CID 86827180
pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 86827180) has the molecular formula C17H20FNO4S and a molecular weight of 353.42 g/mol. Its IUPAC name is pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 86827180 |
| Molecular Formula | C17H20FNO4S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | C#CCCCOC(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H20FNO4S/c1-2-3-6-13-23-17(20)14-9-11-19(12-10-14)24(21,22)16-8-5-4-7-15(16)18/h1,4-5,7-8,14H,3,6,9-13H2 |
| InChIKey | KHOUSNXTEKMVBN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|