About pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate
pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 86827180) has the molecular formula C17H20FNO4S
and a molecular weight of 353.42 g/mol. Its IUPAC name is pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| PubChem CID | 86827180 |
| Molecular Formula | C17H20FNO4S |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | C#CCCCOC(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H20FNO4S/c1-2-3-6-13-23-17(20)14-9-11-19(12-10-14)24(21,22)16-8-5-4-7-15(16)18/h1,4-5,7-8,14H,3,6,9-13H2 |
| InChIKey | KHOUSNXTEKMVBN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate?
The IUPAC name of pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate (CID 86827180) is pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate.
What is the SMILES notation for pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate?
The canonical SMILES for pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate is C#CCCCOC(=O)C1CCN(S(=O)(=O)c2ccccc2F)CC1.
What is the InChIKey of pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate?
The InChIKey is KHOUSNXTEKMVBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FNO4S/c1-2-3-6-13-23-17(20)14-9-11-19(12-10-14)24(21,22)16-8-5-4-7-15(16)18/h1,4-5,7-8,14H,3,6,9-13H2.
What are the key properties of pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate?
pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate has a molecular weight of 353.42 g/mol, XLogP of 2.18, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-ynyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate is sourced from PubChem (CID 86827180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).