C19H19FN2O6S — CID 55319698
(2-nitrophenyl)methyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 55319698) has the molecular formula C19H19FN2O6S and a molecular weight of 422.43 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (2-nitrophenyl)methyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55319698 |
| Molecular Formula | C19H19FN2O6S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (2-nitrophenyl)methyl 1-(2-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1[N+](=O)[O-])C1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H19FN2O6S/c20-16-6-2-4-8-18(16)29(26,27)21-11-9-14(10-12-21)19(23)28-13-15-5-1-3-7-17(15)22(24)25/h1-8,14H,9-13H2 |
| InChIKey | GBXFFBFGASDKNE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|