C21H24FNO5S — CID 7739799
(2-ethoxyphenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 7739799) has the molecular formula C21H24FNO5S and a molecular weight of 421.49 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (2-ethoxyphenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 7739799 |
| Molecular Formula | C21H24FNO5S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (2-ethoxyphenyl)methyl 1-(4-fluorophenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOc1ccccc1COC(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H24FNO5S/c1-2-27-20-6-4-3-5-17(20)15-28-21(24)16-11-13-23(14-12-16)29(25,26)19-9-7-18(22)8-10-19/h3-10,16H,2,11-15H2,1H3 |
| InChIKey | HYZQLGKSOMUKDZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |