C22H24F3NO5S — CID 31400592
(2-ethoxyphenyl)methyl 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 31400592) has the molecular formula C22H24F3NO5S and a molecular weight of 471.50 g/mol. Its IUPAC name is (2-ethoxyphenyl)methyl 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | (2-ethoxyphenyl)methyl 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 31400592 |
| Molecular Formula | C22H24F3NO5S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | (2-ethoxyphenyl)methyl 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | CCOc1ccccc1COC(=O)C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H24F3NO5S/c1-2-30-20-9-4-3-6-17(20)15-31-21(27)16-10-12-26(13-11-16)32(28,29)19-8-5-7-18(14-19)22(23,24)25/h3-9,14,16H,2,10-13,15H2,1H3 |
| InChIKey | TZILEBBRVSQEDV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |