C20H19ClF3NO4S — CID 46791128
(3-chlorophenyl)methyl 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate (PubChem CID 46791128) has the molecular formula C20H19ClF3NO4S and a molecular weight of 461.89 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate.
| Compound Name | (3-chlorophenyl)methyl 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 46791128 |
| Molecular Formula | C20H19ClF3NO4S |
| Molecular Weight | 461.89 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | (3-chlorophenyl)methyl 1-[3-(trifluoromethyl)phenyl]sulfonylpiperidine-4-carboxylate |
| SMILES | O=C(OCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H19ClF3NO4S/c21-17-5-1-3-14(11-17)13-29-19(26)15-7-9-25(10-8-15)30(27,28)18-6-2-4-16(12-18)20(22,23)24/h1-6,11-12,15H,7-10,13H2 |
| InChIKey | IDEJZVWPXNSXCN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.89 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |