C18H18ClNO4S — CID 7699907
(3-chlorophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 7699907) has the molecular formula C18H18ClNO4S and a molecular weight of 379.87 g/mol. Its IUPAC name is (3-chlorophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (3-chlorophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7699907 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | (3-chlorophenyl)methyl 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCc1cccc(Cl)c1)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H18ClNO4S/c19-16-7-3-5-14(11-16)13-24-18(21)15-6-4-8-17(12-15)25(22,23)20-9-1-2-10-20/h3-8,11-12H,1-2,9-10,13H2 |
| InChIKey | MSDWBFLJXGYOTP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |