C26H24Br2ClNO4S — CID 166346000
(3,5-dibromo-4-chlorophenyl)methyl 3-(4-benzylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 166346000) has the molecular formula C26H24Br2ClNO4S and a molecular weight of 641.81 g/mol. Its IUPAC name is (3,5-dibromo-4-chlorophenyl)methyl 3-(4-benzylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (3,5-dibromo-4-chlorophenyl)methyl 3-(4-benzylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 166346000 |
| Molecular Formula | C26H24Br2ClNO4S |
| Molecular Weight | 641.81 g/mol |
| Exact Mass | 638.95 |
| IUPAC Name | (3,5-dibromo-4-chlorophenyl)methyl 3-(4-benzylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | O=C(OCc1cc(Br)c(Cl)c(Br)c1)c1cccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H24Br2ClNO4S/c27-23-14-20(15-24(28)25(23)29)17-34-26(31)21-7-4-8-22(16-21)35(32,33)30-11-9-19(10-12-30)13-18-5-2-1-3-6-18/h1-8,14-16,19H,9-13,17H2 |
| InChIKey | OVXCDXVQJDKGJT-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.81 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|