C22H28N2O5S2 — CID 651778
4-[3-(4-benzylpiperidin-1-yl)sulfonylphenyl]sulfonylmorpholine (PubChem CID 651778) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 4-[3-(4-benzylpiperidin-1-yl)sulfonylphenyl]sulfonylmorpholine.
| Compound Name | 4-[3-(4-benzylpiperidin-1-yl)sulfonylphenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 651778 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 4-[3-(4-benzylpiperidin-1-yl)sulfonylphenyl]sulfonylmorpholine |
| SMILES | O=S(=O)(c1cccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)c1)N1CCOCC1 |
| InChI | InChI=1S/C22H28N2O5S2/c25-30(26,23-11-9-20(10-12-23)17-19-5-2-1-3-6-19)21-7-4-8-22(18-21)31(27,28)24-13-15-29-16-14-24/h1-8,18,20H,9-17H2 |
| InChIKey | WCGDVPSQFXIICA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |