C20H23NO4S — CID 1129609
4-benzyl-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine (PubChem CID 1129609) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 4-benzyl-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine.
| Compound Name | 4-benzyl-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine |
|---|---|
| PubChem CID | 1129609 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-benzyl-1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCCO2)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23NO4S/c22-26(23,18-6-7-19-20(15-18)25-13-12-24-19)21-10-8-17(9-11-21)14-16-4-2-1-3-5-16/h1-7,15,17H,8-14H2 |
| InChIKey | JCYYHCPDZICGJX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |