C19H21NO5S — CID 110396758
1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-phenoxypiperidine (PubChem CID 110396758) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-phenoxypiperidine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-phenoxypiperidine |
|---|---|
| PubChem CID | 110396758 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-phenoxypiperidine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCCO2)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C19H21NO5S/c21-26(22,17-6-7-18-19(14-17)24-13-12-23-18)20-10-8-16(9-11-20)25-15-4-2-1-3-5-15/h1-7,14,16H,8-13H2 |
| InChIKey | WKWYQWUKRRFIII-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |