C21H23NO6S — CID 18272301
(3-methylphenyl) 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate (PubChem CID 18272301) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is (3-methylphenyl) 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate.
| Compound Name | (3-methylphenyl) 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 18272301 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (3-methylphenyl) 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate |
| SMILES | Cc1cccc(OC(=O)C2CCN(S(=O)(=O)c3ccc4c(c3)OCCO4)CC2)c1 |
| InChI | InChI=1S/C21H23NO6S/c1-15-3-2-4-17(13-15)28-21(23)16-7-9-22(10-8-16)29(24,25)18-5-6-19-20(14-18)27-12-11-26-19/h2-6,13-14,16H,7-12H2,1H3 |
| InChIKey | YHNIZXQKMTZUJH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|