C19H23NO6S — CID 47087452
2-methylbut-3-yn-2-yl 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate (PubChem CID 47087452) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is 2-methylbut-3-yn-2-yl 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate.
| Compound Name | 2-methylbut-3-yn-2-yl 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 47087452 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-methylbut-3-yn-2-yl 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidine-4-carboxylate |
| SMILES | C#CC(C)(C)OC(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C19H23NO6S/c1-4-19(2,3)26-18(21)14-7-9-20(10-8-14)27(22,23)15-5-6-16-17(13-15)25-12-11-24-16/h1,5-6,13-14H,7-12H2,2-3H3 |
| InChIKey | YTBSLGKXUMBIGV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|