C21H22N2O4S — CID 113087895
2-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-1H-indole (PubChem CID 113087895) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-1H-indole.
| Compound Name | 2-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-1H-indole |
|---|---|
| PubChem CID | 113087895 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-[1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperidin-4-yl]-1H-indole |
| SMILES | O=S(=O)(c1ccc2c(c1)OCCO2)N1CCC(c2cc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C21H22N2O4S/c24-28(25,17-5-6-20-21(14-17)27-12-11-26-20)23-9-7-15(8-10-23)19-13-16-3-1-2-4-18(16)22-19/h1-6,13-15,22H,7-12H2 |
| InChIKey | ZBYOURPMPCWKNI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |