C21H22N2O4S — CID 113087351
3-[1-(1,3-benzodioxol-5-ylsulfonyl)piperidin-4-yl]-2-methyl-1H-indole (PubChem CID 113087351) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-[1-(1,3-benzodioxol-5-ylsulfonyl)piperidin-4-yl]-2-methyl-1H-indole.
| Compound Name | 3-[1-(1,3-benzodioxol-5-ylsulfonyl)piperidin-4-yl]-2-methyl-1H-indole |
|---|---|
| PubChem CID | 113087351 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3-[1-(1,3-benzodioxol-5-ylsulfonyl)piperidin-4-yl]-2-methyl-1H-indole |
| SMILES | Cc1[nH]c2ccccc2c1C1CCN(S(=O)(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H22N2O4S/c1-14-21(17-4-2-3-5-18(17)22-14)15-8-10-23(11-9-15)28(24,25)16-6-7-19-20(12-16)27-13-26-19/h2-7,12,15,22H,8-11,13H2,1H3 |
| InChIKey | MUIQETTVRKWFSX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|